methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate

C11H12N2O2 — CID 59565193

IUPACmethyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate
SMILESCOC(=O)c1ccn2c(C)ncc2c1C
InChIInChI=1S/C11H12N2O2/c1-7-9(11(14)15-3)4-5-13-8(2)12-6-10(7)13/h4-6H,1-3H3
InChIKeySUEPLRZWUMBOQH-UHFFFAOYSA-N
MW204.23 g/mol
LogP1.74
Rot. Bonds1

About methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate

methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate (PubChem CID 59565193) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate.

Molecular Properties

Compound Namemethyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate
PubChem CID59565193
Molecular FormulaC11H12N2O2
Molecular Weight204.23 g/mol
Exact Mass204.09
IUPAC Namemethyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate
SMILESCOC(=O)c1ccn2c(C)ncc2c1C
InChIInChI=1S/C11H12N2O2/c1-7-9(11(14)15-3)4-5-13-8(2)12-6-10(7)13/h4-6H,1-3H3
InChIKeySUEPLRZWUMBOQH-UHFFFAOYSA-N
XLogP1.74
TPSA43.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.23
LogP ≤ 51.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate?
The IUPAC name of methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate (CID 59565193) is methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate.
What is the SMILES notation for methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate?
The canonical SMILES for methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate is COC(=O)c1ccn2c(C)ncc2c1C.
What is the InChIKey of methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate?
The InChIKey is SUEPLRZWUMBOQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-7-9(11(14)15-3)4-5-13-8(2)12-6-10(7)13/h4-6H,1-3H3.
What are the key properties of methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate?
methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate has a molecular weight of 204.23 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,8-dimethylimidazo[1,5-a]pyridine-7-carboxylate is sourced from PubChem (CID 59565193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).