C15H26O4Si — CID 59566878
triethoxy-(6-methoxy-2,3-dimethylphenyl)silane (PubChem CID 59566878) has the molecular formula C15H26O4Si and a molecular weight of 298.45 g/mol. Its IUPAC name is triethoxy-(6-methoxy-2,3-dimethylphenyl)silane.
| Compound Name | triethoxy-(6-methoxy-2,3-dimethylphenyl)silane |
|---|---|
| PubChem CID | 59566878 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | triethoxy-(6-methoxy-2,3-dimethylphenyl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1c(OC)ccc(C)c1C |
| InChI | InChI=1S/C15H26O4Si/c1-7-17-20(18-8-2,19-9-3)15-13(5)12(4)10-11-14(15)16-6/h10-11H,7-9H2,1-6H3 |
| InChIKey | OMYROSIUXRSFDG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|