C26H23NO2S — CID 59573731
2,9-dimethyl-6-(5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide (PubChem CID 59573731) has the molecular formula C26H23NO2S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2,9-dimethyl-6-(5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide.
| Compound Name | 2,9-dimethyl-6-(5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide |
|---|---|
| PubChem CID | 59573731 |
| Molecular Formula | C26H23NO2S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2,9-dimethyl-6-(5,6,7,8-tetrahydronaphthalen-1-yl)-[1]benzofuro[3,2-b][1,4]benzothiazine 11-oxide |
| SMILES | Cc1ccc2c(c1)S(=O)c1c(oc3ccc(C)cc13)N2c1cccc2c1CCCC2 |
| InChI | InChI=1S/C26H23NO2S/c1-16-11-13-23-20(14-16)25-26(29-23)27(22-12-10-17(2)15-24(22)30(25)28)21-9-5-7-18-6-3-4-8-19(18)21/h5,7,9-15H,3-4,6,8H2,1-2H3 |
| InChIKey | MVBIDAWZJOMHSB-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |