C13H12N4S — CID 59591134
[5-(cyanomethyl)isoquinolin-8-yl]methyl carbamimidothioate (PubChem CID 59591134) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is [5-(cyanomethyl)isoquinolin-8-yl]methyl carbamimidothioate.
| Compound Name | [5-(cyanomethyl)isoquinolin-8-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 59591134 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [5-(cyanomethyl)isoquinolin-8-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1ccc(CC#N)c2ccncc12 |
| InChI | InChI=1S/C13H12N4S/c14-5-3-9-1-2-10(8-18-13(15)16)12-7-17-6-4-11(9)12/h1-2,4,6-7H,3,8H2,(H3,15,16) |
| InChIKey | RBXHPWGHIPGGKS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|