C13H14N2S2 — CID 89221158
[1-(sulfanylmethyl)naphthalen-2-yl]methyl carbamimidothioate (PubChem CID 89221158) has the molecular formula C13H14N2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is [1-(sulfanylmethyl)naphthalen-2-yl]methyl carbamimidothioate.
| Compound Name | [1-(sulfanylmethyl)naphthalen-2-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 89221158 |
| Molecular Formula | C13H14N2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | [1-(sulfanylmethyl)naphthalen-2-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1ccc2ccccc2c1CS |
| InChI | InChI=1S/C13H14N2S2/c14-13(15)17-8-10-6-5-9-3-1-2-4-11(9)12(10)7-16/h1-6,16H,7-8H2,(H3,14,15) |
| InChIKey | LQBRPQZZGBSAEV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|