C16H14N2O5 — CID 59599864
4-(3-formyl-4-hydroxy-5-nitrophenyl)-N,N-dimethylbenzamide (PubChem CID 59599864) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 4-(3-formyl-4-hydroxy-5-nitrophenyl)-N,N-dimethylbenzamide.
| Compound Name | 4-(3-formyl-4-hydroxy-5-nitrophenyl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 59599864 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-(3-formyl-4-hydroxy-5-nitrophenyl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2cc(C=O)c(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H14N2O5/c1-17(2)16(21)11-5-3-10(4-6-11)12-7-13(9-19)15(20)14(8-12)18(22)23/h3-9,20H,1-2H3 |
| InChIKey | ABQUNDUUWZFYNT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|