C29H41N9O2Si — CID 59613365
N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[6-[(5-isocyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)-3-pyridinyl]pyrrole-3-carboxamide (PubChem CID 59613365) has the molecular formula C29H41N9O2Si and a molecular weight of 575.79 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[6-[(5-isocyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)-3-pyridinyl]pyrrole-3-carboxamide.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[6-[(5-isocyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)-3-pyridinyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59613365 |
| Molecular Formula | C29H41N9O2Si |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[6-[(5-isocyanopyrazin-2-yl)amino]-4-(piperidin-3-ylmethylamino)-3-pyridinyl]pyrrole-3-carboxamide |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(NCC3CCCNC3)c(-n3ccc(C(=O)NCCO[Si](C)(C)C(C)(C)C)c3)cn2)cn1 |
| InChI | InChI=1S/C29H41N9O2Si/c1-29(2,3)41(5,6)40-13-11-32-28(39)22-9-12-38(20-22)24-17-34-25(37-27-19-35-26(30-4)18-36-27)14-23(24)33-16-21-8-7-10-31-15-21/h9,12,14,17-21,31H,7-8,10-11,13,15-16H2,1-3,5-6H3,(H,32,39)(H2,33,34,36,37) |
| InChIKey | GPPQNVIGYXPBHL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|