C26H25N3 — CID 59620902
(1S,9R,12S,13S)-14-benzyl-11-phenyl-8,10,14-triazapentacyclo[7.7.0.01,13.02,7.010,12]hexadeca-2,4,6-triene (PubChem CID 59620902) has the molecular formula C26H25N3 and a molecular weight of 379.51 g/mol. Its IUPAC name is (1S,9R,12S,13S)-14-benzyl-11-phenyl-8,10,14-triazapentacyclo[7.7.0.01,13.02,7.010,12]hexadeca-2,4,6-triene.
| Compound Name | (1S,9R,12S,13S)-14-benzyl-11-phenyl-8,10,14-triazapentacyclo[7.7.0.01,13.02,7.010,12]hexadeca-2,4,6-triene |
|---|---|
| PubChem CID | 59620902 |
| Molecular Formula | C26H25N3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (1S,9R,12S,13S)-14-benzyl-11-phenyl-8,10,14-triazapentacyclo[7.7.0.01,13.02,7.010,12]hexadeca-2,4,6-triene |
| SMILES | c1ccc(CN2CC[C@@]34c5ccccc5N[C@@H]3N3C(c5ccccc5)[C@@H]3[C@@H]24)cc1 |
| InChI | InChI=1S/C26H25N3/c1-3-9-18(10-4-1)17-28-16-15-26-20-13-7-8-14-21(20)27-25(26)29-22(23(29)24(26)28)19-11-5-2-6-12-19/h1-14,22-25,27H,15-17H2/t22?,23-,24-,25-,26+,29?/m1/s1 |
| InChIKey | VTKVEWQHDQGKAU-ULTWWPKOSA-N |
| XLogP | 4.39 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|