C32H31N3S — CID 71104375
(9S)-13-benzyl-11-[(S)-phenyl(phenylsulfanyl)methyl]-8,10,13-triazatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6-triene (PubChem CID 71104375) has the molecular formula C32H31N3S and a molecular weight of 489.69 g/mol. Its IUPAC name is (9S)-13-benzyl-11-[(S)-phenyl(phenylsulfanyl)methyl]-8,10,13-triazatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6-triene.
| Compound Name | (9S)-13-benzyl-11-[(S)-phenyl(phenylsulfanyl)methyl]-8,10,13-triazatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6-triene |
|---|---|
| PubChem CID | 71104375 |
| Molecular Formula | C32H31N3S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (9S)-13-benzyl-11-[(S)-phenyl(phenylsulfanyl)methyl]-8,10,13-triazatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6-triene |
| SMILES | c1ccc(CN2CCC34c5ccccc5N[C@@H]3NC([C@@H](Sc3ccccc3)c3ccccc3)C24)cc1 |
| InChI | InChI=1S/C32H31N3S/c1-4-12-23(13-5-1)22-35-21-20-32-26-18-10-11-19-27(26)33-31(32)34-28(30(32)35)29(24-14-6-2-7-15-24)36-25-16-8-3-9-17-25/h1-19,28-31,33-34H,20-22H2/t28?,29-,30?,31+,32?/m0/s1 |
| InChIKey | RILJPLZHGUHZLC-YQCVNLRYSA-N |
| XLogP | 6.46 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |