C27H14IrNS- — CID 59622151
3-(2H-dibenzothiophen-2-id-3-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium (PubChem CID 59622151) has the molecular formula C27H14IrNS- and a molecular weight of 576.70 g/mol. Its IUPAC name is 3-(2H-dibenzothiophen-2-id-3-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium.
| Compound Name | 3-(2H-dibenzothiophen-2-id-3-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium |
|---|---|
| PubChem CID | 59622151 |
| Molecular Formula | C27H14IrNS- |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | 3-(2H-dibenzothiophen-2-id-3-yl)-4-azatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5,7,9(16),10,12,14-octaene;iridium |
| SMILES | [Ir].[c-]1cc2c(cc1-c1cc3c4c(cccc4n1)-c1ccccc1-3)sc1ccccc12 |
| InChI | InChI=1S/C27H14NS.Ir/c1-2-7-18-17(6-1)21-9-5-10-23-27(21)22(18)15-24(28-23)16-12-13-20-19-8-3-4-11-25(19)29-26(20)14-16;/h1-11,13-15H;/q-1; |
| InChIKey | FDGRQHZGSBCXHE-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|