C30H19F3N5O2+ — CID 59623673
3-[4-fluoro-3-(6-fluoro-3-pyridinyl)phenyl]-1-[[6-(6-fluoro-3-pyridinyl)-3-pyridinyl]methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 59623673) has the molecular formula C30H19F3N5O2+ and a molecular weight of 538.51 g/mol. Its IUPAC name is 3-[4-fluoro-3-(6-fluoro-3-pyridinyl)phenyl]-1-[[6-(6-fluoro-3-pyridinyl)-3-pyridinyl]methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 3-[4-fluoro-3-(6-fluoro-3-pyridinyl)phenyl]-1-[[6-(6-fluoro-3-pyridinyl)-3-pyridinyl]methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 59623673 |
| Molecular Formula | C30H19F3N5O2+ |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 3-[4-fluoro-3-(6-fluoro-3-pyridinyl)phenyl]-1-[[6-(6-fluoro-3-pyridinyl)-3-pyridinyl]methyl]-2-hydroxypyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | O=c1c(-c2ccc(F)c(-c3ccc(F)nc3)c2)c(O)[n+](Cc2ccc(-c3ccc(F)nc3)nc2)c2ccccn12 |
| InChI | InChI=1S/C30H18F3N5O2/c31-23-8-5-19(13-22(23)20-6-10-25(32)35-15-20)28-29(39)37-12-2-1-3-27(37)38(30(28)40)17-18-4-9-24(34-14-18)21-7-11-26(33)36-16-21/h1-16H,17H2/p+1 |
| InChIKey | UMJSSHKSZFMVBI-UHFFFAOYSA-O |
| XLogP | 4.94 |
| TPSA | 84.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|