C15H16N2O2 — CID 59628738
(2R,5R)-5-benzyl-2-(furan-2-yl)-3-methylimidazolidin-4-one (PubChem CID 59628738) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (2R,5R)-5-benzyl-2-(furan-2-yl)-3-methylimidazolidin-4-one.
| Compound Name | (2R,5R)-5-benzyl-2-(furan-2-yl)-3-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 59628738 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (2R,5R)-5-benzyl-2-(furan-2-yl)-3-methylimidazolidin-4-one |
| SMILES | CN1C(=O)[C@@H](Cc2ccccc2)N[C@H]1c1ccco1 |
| InChI | InChI=1S/C15H16N2O2/c1-17-14(13-8-5-9-19-13)16-12(15(17)18)10-11-6-3-2-4-7-11/h2-9,12,14,16H,10H2,1H3/t12-,14-/m1/s1 |
| InChIKey | AXHYJCVUTFGPER-TZMCWYRMSA-N |
| XLogP | 1.95 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |