C54H52N2 — CID 59639048
N-ethyl-4-[2-[4-[2-[4-[ethyl-[[4-(4-methylphenyl)phenyl]methyl]amino]phenyl]ethenyl]phenyl]ethenyl]-N-[[4-(4-methylphenyl)phenyl]methyl]aniline (PubChem CID 59639048) has the molecular formula C54H52N2 and a molecular weight of 729.02 g/mol. Its IUPAC name is N-ethyl-4-[2-[4-[2-[4-[ethyl-[[4-(4-methylphenyl)phenyl]methyl]amino]phenyl]ethenyl]phenyl]ethenyl]-N-[[4-(4-methylphenyl)phenyl]methyl]aniline.
| Compound Name | N-ethyl-4-[2-[4-[2-[4-[ethyl-[[4-(4-methylphenyl)phenyl]methyl]amino]phenyl]ethenyl]phenyl]ethenyl]-N-[[4-(4-methylphenyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 59639048 |
| Molecular Formula | C54H52N2 |
| Molecular Weight | 729.02 g/mol |
| Exact Mass | 728.41 |
| IUPAC Name | N-ethyl-4-[2-[4-[2-[4-[ethyl-[[4-(4-methylphenyl)phenyl]methyl]amino]phenyl]ethenyl]phenyl]ethenyl]-N-[[4-(4-methylphenyl)phenyl]methyl]aniline |
| SMILES | CCN(Cc1ccc(-c2ccc(C)cc2)cc1)c1ccc(C=Cc2ccc(C=Cc3ccc(N(CC)Cc4ccc(-c5ccc(C)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H52N2/c1-5-55(39-47-19-31-51(32-20-47)49-27-7-41(3)8-28-49)53-35-23-45(24-36-53)17-15-43-11-13-44(14-12-43)16-18-46-25-37-54(38-26-46)56(6-2)40-48-21-33-52(34-22-48)50-29-9-42(4)10-30-50/h7-38H,5-6,39-40H2,1-4H3 |
| InChIKey | AAGZPSPDWHTVHK-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.02 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|