C34H42N2O10 — CID 59642286
4-butoxycarbonyl-7-(2-hydroxyethoxy)-2-methyl-6-[[4-methyl-2,5-dioxo-1-[4-(phenylcarbamoyl)phenyl]pyrrolidin-3-yl]methyl]-7-oxoheptanoic acid (PubChem CID 59642286) has the molecular formula C34H42N2O10 and a molecular weight of 638.71 g/mol. Its IUPAC name is 4-butoxycarbonyl-7-(2-hydroxyethoxy)-2-methyl-6-[[4-methyl-2,5-dioxo-1-[4-(phenylcarbamoyl)phenyl]pyrrolidin-3-yl]methyl]-7-oxoheptanoic acid.
| Compound Name | 4-butoxycarbonyl-7-(2-hydroxyethoxy)-2-methyl-6-[[4-methyl-2,5-dioxo-1-[4-(phenylcarbamoyl)phenyl]pyrrolidin-3-yl]methyl]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 59642286 |
| Molecular Formula | C34H42N2O10 |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | 4-butoxycarbonyl-7-(2-hydroxyethoxy)-2-methyl-6-[[4-methyl-2,5-dioxo-1-[4-(phenylcarbamoyl)phenyl]pyrrolidin-3-yl]methyl]-7-oxoheptanoic acid |
| SMILES | CCCCOC(=O)C(CC(C)C(=O)O)CC(CC1C(=O)N(c2ccc(C(=O)Nc3ccccc3)cc2)C(=O)C1C)C(=O)OCCO |
| InChI | InChI=1S/C34H42N2O10/c1-4-5-16-45-33(43)24(18-21(2)32(41)42)19-25(34(44)46-17-15-37)20-28-22(3)30(39)36(31(28)40)27-13-11-23(12-14-27)29(38)35-26-9-7-6-8-10-26/h6-14,21-22,24-25,28,37H,4-5,15-20H2,1-3H3,(H,35,38)(H,41,42) |
| InChIKey | CYUKJDMNPOAFIX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 176.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|