C30H38N4O8 — CID 130192835
4-carbamoyl-6-cyano-7-(4-methyl-2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-[2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylamino]-3-oxopropyl]heptanoic acid (PubChem CID 130192835) has the molecular formula C30H38N4O8 and a molecular weight of 582.65 g/mol. Its IUPAC name is 4-carbamoyl-6-cyano-7-(4-methyl-2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-[2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylamino]-3-oxopropyl]heptanoic acid.
| Compound Name | 4-carbamoyl-6-cyano-7-(4-methyl-2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-[2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylamino]-3-oxopropyl]heptanoic acid |
|---|---|
| PubChem CID | 130192835 |
| Molecular Formula | C30H38N4O8 |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 4-carbamoyl-6-cyano-7-(4-methyl-2,5-dioxo-1-phenylpyrrolidin-3-yl)-2-[2-methyl-3-[2-(2-methylprop-2-enoyloxy)ethylamino]-3-oxopropyl]heptanoic acid |
| SMILES | C=C(C)C(=O)OCCNC(=O)C(C)CC(CC(CC(C#N)CC1C(=O)N(c2ccccc2)C(=O)C1C)C(N)=O)C(=O)O |
| InChI | InChI=1S/C30H38N4O8/c1-17(2)30(41)42-11-10-33-26(36)18(3)12-22(29(39)40)15-21(25(32)35)13-20(16-31)14-24-19(4)27(37)34(28(24)38)23-8-6-5-7-9-23/h5-9,18-22,24H,1,10-15H2,2-4H3,(H2,32,35)(H,33,36)(H,39,40) |
| InChIKey | JYEBJVKLYPBKGA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 196.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|