C27H43NO9 — CID 59642360
4-butoxycarbonyl-6-[(1-cyclohexyl-4-methyl-2,5-dioxopyrrolidin-3-yl)methyl]-7-(2-hydroxyethoxy)-2-methyl-7-oxoheptanoic acid (PubChem CID 59642360) has the molecular formula C27H43NO9 and a molecular weight of 525.64 g/mol. Its IUPAC name is 4-butoxycarbonyl-6-[(1-cyclohexyl-4-methyl-2,5-dioxopyrrolidin-3-yl)methyl]-7-(2-hydroxyethoxy)-2-methyl-7-oxoheptanoic acid.
| Compound Name | 4-butoxycarbonyl-6-[(1-cyclohexyl-4-methyl-2,5-dioxopyrrolidin-3-yl)methyl]-7-(2-hydroxyethoxy)-2-methyl-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 59642360 |
| Molecular Formula | C27H43NO9 |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 4-butoxycarbonyl-6-[(1-cyclohexyl-4-methyl-2,5-dioxopyrrolidin-3-yl)methyl]-7-(2-hydroxyethoxy)-2-methyl-7-oxoheptanoic acid |
| SMILES | CCCCOC(=O)C(CC(C)C(=O)O)CC(CC1C(=O)N(C2CCCCC2)C(=O)C1C)C(=O)OCCO |
| InChI | InChI=1S/C27H43NO9/c1-4-5-12-36-26(34)19(14-17(2)25(32)33)15-20(27(35)37-13-11-29)16-22-18(3)23(30)28(24(22)31)21-9-7-6-8-10-21/h17-22,29H,4-16H2,1-3H3,(H,32,33) |
| InChIKey | GUPLZTMNKWWTIV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|