C35H30N4Pt — CID 59645944
1-(3-tert-butylbenzene-6-id-1-yl)-3-[diphenyl-(1-phenylpyrazol-3-yl)methyl]pyrazole;platinum(2+) (PubChem CID 59645944) has the molecular formula C35H30N4Pt and a molecular weight of 701.73 g/mol. Its IUPAC name is 1-(3-tert-butylbenzene-6-id-1-yl)-3-[diphenyl-(1-phenylpyrazol-3-yl)methyl]pyrazole;platinum(2+).
| Compound Name | 1-(3-tert-butylbenzene-6-id-1-yl)-3-[diphenyl-(1-phenylpyrazol-3-yl)methyl]pyrazole;platinum(2+) |
|---|---|
| PubChem CID | 59645944 |
| Molecular Formula | C35H30N4Pt |
| Molecular Weight | 701.73 g/mol |
| Exact Mass | 701.21 |
| IUPAC Name | 1-(3-tert-butylbenzene-6-id-1-yl)-3-[diphenyl-(1-phenylpyrazol-3-yl)methyl]pyrazole;platinum(2+) |
| SMILES | CC(C)(C)c1cc[c-]c(-n2ccc(C(c3ccccc3)(c3ccccc3)c3ccn(-c4[c-]cccc4)n3)n2)c1.[Pt+2] |
| InChI | InChI=1S/C35H30N4.Pt/c1-34(2,3)29-18-13-21-31(26-29)39-25-23-33(37-39)35(27-14-7-4-8-15-27,28-16-9-5-10-17-28)32-22-24-38(36-32)30-19-11-6-12-20-30;/h4-19,22-26H,1-3H3;/q-2;+2 |
| InChIKey | RXHCZNBXHALVDF-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.73 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|