C32H33N5Pt — CID 59661053
5-tert-butyl-N-(5-tert-butyl-1-phenylpyrazol-3-yl)-N-phenyl-1-phenylpyrazol-3-amine;platinum(2+) (PubChem CID 59661053) has the molecular formula C32H33N5Pt and a molecular weight of 682.73 g/mol. Its IUPAC name is 5-tert-butyl-N-(5-tert-butyl-1-phenylpyrazol-3-yl)-N-phenyl-1-phenylpyrazol-3-amine;platinum(2+).
| Compound Name | 5-tert-butyl-N-(5-tert-butyl-1-phenylpyrazol-3-yl)-N-phenyl-1-phenylpyrazol-3-amine;platinum(2+) |
|---|---|
| PubChem CID | 59661053 |
| Molecular Formula | C32H33N5Pt |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.24 |
| IUPAC Name | 5-tert-butyl-N-(5-tert-butyl-1-phenylpyrazol-3-yl)-N-phenyl-1-phenylpyrazol-3-amine;platinum(2+) |
| SMILES | CC(C)(C)c1cc(N(c2ccccc2)c2cc(C(C)(C)C)n(-c3[c-]cccc3)n2)nn1-c1[c-]cccc1.[Pt+2] |
| InChI | InChI=1S/C32H33N5.Pt/c1-31(2,3)27-22-29(33-36(27)25-18-12-8-13-19-25)35(24-16-10-7-11-17-24)30-23-28(32(4,5)6)37(34-30)26-20-14-9-15-21-26;/h7-18,20,22-23H,1-6H3;/q-2;+2 |
| InChIKey | JATALOFPRHUPSJ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|