C25H21IrN2- — CID 21044959
3-tert-butyl-2-phenylphenanthro[9,10-c]pyrazole;iridium (PubChem CID 21044959) has the molecular formula C25H21IrN2- and a molecular weight of 541.67 g/mol. Its IUPAC name is 3-tert-butyl-2-phenylphenanthro[9,10-c]pyrazole;iridium.
| Compound Name | 3-tert-butyl-2-phenylphenanthro[9,10-c]pyrazole;iridium |
|---|---|
| PubChem CID | 21044959 |
| Molecular Formula | C25H21IrN2- |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 3-tert-butyl-2-phenylphenanthro[9,10-c]pyrazole;iridium |
| SMILES | CC(C)(C)c1c2c3ccccc3c3ccccc3c2nn1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C25H21N2.Ir/c1-25(2,3)24-22-20-15-9-7-13-18(20)19-14-8-10-16-21(19)23(22)26-27(24)17-11-5-4-6-12-17;/h4-11,13-16H,1-3H3;/q-1; |
| InChIKey | GXJMYKOYWSHAOH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|