C22H2F18N6 — CID 59650545
4,5,10,11,18,19-hexakis(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene (PubChem CID 59650545) has the molecular formula C22H2F18N6 and a molecular weight of 692.26 g/mol. Its IUPAC name is 4,5,10,11,18,19-hexakis(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene.
| Compound Name | 4,5,10,11,18,19-hexakis(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene |
|---|---|
| PubChem CID | 59650545 |
| Molecular Formula | C22H2F18N6 |
| Molecular Weight | 692.26 g/mol |
| Exact Mass | 692.01 |
| IUPAC Name | 4,5,10,11,18,19-hexakis(trifluoromethyl)-3,6,9,12,15,22-hexazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),3,5,8(13),9,11,14,16(21),17,19-undecaene |
| SMILES | FC(F)(F)c1cc2nc3c4nc(C(F)(F)F)c(C(F)(F)F)nc4c4nc(C(F)(F)F)c(C(F)(F)F)nc4c3nc2cc1C(F)(F)F |
| InChI | InChI=1S/C22H2F18N6/c23-17(24,25)3-1-5-6(2-4(3)18(26,27)28)42-8-7(41-5)9-11(45-15(21(35,36)37)13(43-9)19(29,30)31)12-10(8)44-14(20(32,33)34)16(46-12)22(38,39)40/h1-2H |
| InChIKey | AESKEUDBLRLDTL-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.26 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|