C21H14Cl2N2O3 — CID 59654756
(E)-3-[3-[[6-(3,5-dichlorophenyl)pyridine-2-carbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 59654756) has the molecular formula C21H14Cl2N2O3 and a molecular weight of 413.26 g/mol. Its IUPAC name is (E)-3-[3-[[6-(3,5-dichlorophenyl)pyridine-2-carbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[6-(3,5-dichlorophenyl)pyridine-2-carbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59654756 |
| Molecular Formula | C21H14Cl2N2O3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (E)-3-[3-[[6-(3,5-dichlorophenyl)pyridine-2-carbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(NC(=O)c2cccc(-c3cc(Cl)cc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C21H14Cl2N2O3/c22-15-10-14(11-16(23)12-15)18-5-2-6-19(25-18)21(28)24-17-4-1-3-13(9-17)7-8-20(26)27/h1-12H,(H,24,28)(H,26,27)/b8-7+ |
| InChIKey | WTGPAGVECFCZMI-BQYQJAHWSA-N |
| XLogP | 5.41 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|