C7H15NS — CID 59657956
6,6-dimethylthian-3-amine (PubChem CID 59657956) has the molecular formula C7H15NS and a molecular weight of 145.27 g/mol. Its IUPAC name is 6,6-dimethylthian-3-amine.
| Compound Name | 6,6-dimethylthian-3-amine |
|---|---|
| PubChem CID | 59657956 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 6,6-dimethylthian-3-amine |
| SMILES | CC1(C)CCC(N)CS1 |
| InChI | InChI=1S/C7H15NS/c1-7(2)4-3-6(8)5-9-7/h6H,3-5,8H2,1-2H3 |
| InChIKey | DPKKHKKYXMUHCL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |