C7H13NO2S — CID 18679250
2-amino-5,5-dimethyl-1,4-oxathiepan-7-one (PubChem CID 18679250) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is 2-amino-5,5-dimethyl-1,4-oxathiepan-7-one.
| Compound Name | 2-amino-5,5-dimethyl-1,4-oxathiepan-7-one |
|---|---|
| PubChem CID | 18679250 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 2-amino-5,5-dimethyl-1,4-oxathiepan-7-one |
| SMILES | CC1(C)CC(=O)OC(N)CS1 |
| InChI | InChI=1S/C7H13NO2S/c1-7(2)3-6(9)10-5(8)4-11-7/h5H,3-4,8H2,1-2H3 |
| InChIKey | SJVUNXXQJJATJS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |