C12H13F2NO3 — CID 59658371
(2S)-2-azaniumyl-3-[4-(1,1-difluoro-2-oxopropyl)phenyl]propanoate (PubChem CID 59658371) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is (2S)-2-azaniumyl-3-[4-(1,1-difluoro-2-oxopropyl)phenyl]propanoate.
| Compound Name | (2S)-2-azaniumyl-3-[4-(1,1-difluoro-2-oxopropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 59658371 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2S)-2-azaniumyl-3-[4-(1,1-difluoro-2-oxopropyl)phenyl]propanoate |
| SMILES | CC(=O)C(F)(F)c1ccc(C[C@H]([NH3+])C(=O)[O-])cc1 |
| InChI | InChI=1S/C12H13F2NO3/c1-7(16)12(13,14)9-4-2-8(3-5-9)6-10(15)11(17)18/h2-5,10H,6,15H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | LRMWMXWPWHVYOA-JTQLQIEISA-N |
| XLogP | -0.73 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |