C14H25NO4 — CID 59659430
methyl (Z)-7-(3,3-dimethoxypyrrolidin-2-yl)hept-5-enoate (PubChem CID 59659430) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl (Z)-7-(3,3-dimethoxypyrrolidin-2-yl)hept-5-enoate.
| Compound Name | methyl (Z)-7-(3,3-dimethoxypyrrolidin-2-yl)hept-5-enoate |
|---|---|
| PubChem CID | 59659430 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | methyl (Z)-7-(3,3-dimethoxypyrrolidin-2-yl)hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CC1NCCC1(OC)OC |
| InChI | InChI=1S/C14H25NO4/c1-17-13(16)9-7-5-4-6-8-12-14(18-2,19-3)10-11-15-12/h4,6,12,15H,5,7-11H2,1-3H3/b6-4- |
| InChIKey | SYHUHCRXFLDYCR-XQRVVYSFSA-N |
| XLogP | 1.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|