C24H22N4O8S3 — CID 59660362
[3-methyl-5-[6-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]-1H-benzimidazol-2-yl]-4-(sulfomethyl)phenyl]methanesulfonic acid (PubChem CID 59660362) has the molecular formula C24H22N4O8S3 and a molecular weight of 590.66 g/mol. Its IUPAC name is [3-methyl-5-[6-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]-1H-benzimidazol-2-yl]-4-(sulfomethyl)phenyl]methanesulfonic acid.
| Compound Name | [3-methyl-5-[6-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]-1H-benzimidazol-2-yl]-4-(sulfomethyl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 59660362 |
| Molecular Formula | C24H22N4O8S3 |
| Molecular Weight | 590.66 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | [3-methyl-5-[6-[(2-methyl-3H-benzimidazol-5-yl)sulfonyl]-1H-benzimidazol-2-yl]-4-(sulfomethyl)phenyl]methanesulfonic acid |
| SMILES | Cc1nc2ccc(S(=O)(=O)c3ccc4nc(-c5cc(CS(=O)(=O)O)cc(C)c5CS(=O)(=O)O)[nH]c4c3)cc2[nH]1 |
| InChI | InChI=1S/C24H22N4O8S3/c1-13-7-15(11-37(29,30)31)8-18(19(13)12-38(32,33)34)24-27-21-6-4-17(10-23(21)28-24)39(35,36)16-3-5-20-22(9-16)26-14(2)25-20/h3-10H,11-12H2,1-2H3,(H,25,26)(H,27,28)(H,29,30,31)(H,32,33,34) |
| InChIKey | GKSFUURSBZKTSV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 200.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|