C18H27ClN4O4S2 — CID 59660711
5-chloro-N-[2-[1-(ethylcarbamothioylsulfamoyl)piperidin-4-yl]ethyl]-2-methoxybenzamide (PubChem CID 59660711) has the molecular formula C18H27ClN4O4S2 and a molecular weight of 463.03 g/mol. Its IUPAC name is 5-chloro-N-[2-[1-(ethylcarbamothioylsulfamoyl)piperidin-4-yl]ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-[1-(ethylcarbamothioylsulfamoyl)piperidin-4-yl]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 59660711 |
| Molecular Formula | C18H27ClN4O4S2 |
| Molecular Weight | 463.03 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 5-chloro-N-[2-[1-(ethylcarbamothioylsulfamoyl)piperidin-4-yl]ethyl]-2-methoxybenzamide |
| SMILES | CCNC(=S)NS(=O)(=O)N1CCC(CCNC(=O)c2cc(Cl)ccc2OC)CC1 |
| InChI | InChI=1S/C18H27ClN4O4S2/c1-3-20-18(28)22-29(25,26)23-10-7-13(8-11-23)6-9-21-17(24)15-12-14(19)4-5-16(15)27-2/h4-5,12-13H,3,6-11H2,1-2H3,(H,21,24)(H2,20,22,28) |
| InChIKey | BNZBNPUCARPXFY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.03 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|