C22H33ClN4O4S2 — CID 59660712
5-chloro-N-[2-[1-(cyclohexylcarbamothioylsulfamoyl)piperidin-4-yl]ethyl]-2-methoxybenzamide (PubChem CID 59660712) has the molecular formula C22H33ClN4O4S2 and a molecular weight of 517.12 g/mol. Its IUPAC name is 5-chloro-N-[2-[1-(cyclohexylcarbamothioylsulfamoyl)piperidin-4-yl]ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-[1-(cyclohexylcarbamothioylsulfamoyl)piperidin-4-yl]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 59660712 |
| Molecular Formula | C22H33ClN4O4S2 |
| Molecular Weight | 517.12 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 5-chloro-N-[2-[1-(cyclohexylcarbamothioylsulfamoyl)piperidin-4-yl]ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCC1CCN(S(=O)(=O)NC(=S)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C22H33ClN4O4S2/c1-31-20-8-7-17(23)15-19(20)21(28)24-12-9-16-10-13-27(14-11-16)33(29,30)26-22(32)25-18-5-3-2-4-6-18/h7-8,15-16,18H,2-6,9-14H2,1H3,(H,24,28)(H2,25,26,32) |
| InChIKey | IZUVIPXSKRTQLN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|