C20H17IrNO2-2 — CID 59661438
3-(2H-azulen-2-id-1-yl)-2H-pyridin-2-ide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59661438) has the molecular formula C20H17IrNO2-2 and a molecular weight of 495.58 g/mol. Its IUPAC name is 3-(2H-azulen-2-id-1-yl)-2H-pyridin-2-ide;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 3-(2H-azulen-2-id-1-yl)-2H-pyridin-2-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59661438 |
| Molecular Formula | C20H17IrNO2-2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 3-(2H-azulen-2-id-1-yl)-2H-pyridin-2-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1ncccc1-c1[c-]cc2cccccc1-2 |
| InChI | InChI=1S/C15H9N.C5H8O2.Ir/c1-2-5-12-8-9-15(14(12)7-3-1)13-6-4-10-16-11-13;1-4(6)3-5(2)7;/h1-8,10H;3,6H,1-2H3;/q-2;;/b;4-3-; |
| InChIKey | PNHAYJUVMDMEOE-LWFKIUJUSA-N |
| XLogP | 4.49 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|