C13H12IrNSi- — CID 59661557
5,5-dimethyl-9H-[1]benzosilolo[3,2-b]pyridin-9-ide;iridium (PubChem CID 59661557) has the molecular formula C13H12IrNSi- and a molecular weight of 402.55 g/mol. Its IUPAC name is 5,5-dimethyl-9H-[1]benzosilolo[3,2-b]pyridin-9-ide;iridium.
| Compound Name | 5,5-dimethyl-9H-[1]benzosilolo[3,2-b]pyridin-9-ide;iridium |
|---|---|
| PubChem CID | 59661557 |
| Molecular Formula | C13H12IrNSi- |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 5,5-dimethyl-9H-[1]benzosilolo[3,2-b]pyridin-9-ide;iridium |
| SMILES | C[Si]1(C)c2ccc[c-]c2-c2ncccc21.[Ir] |
| InChI | InChI=1S/C13H12NSi.Ir/c1-15(2)11-7-4-3-6-10(11)13-12(15)8-5-9-14-13;/h3-5,7-9H,1-2H3;/q-1; |
| InChIKey | SJPYWOUQJXVSNZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|