C29H31Cl2N3O4 — CID 59665307
methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-methyl-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoate (PubChem CID 59665307) has the molecular formula C29H31Cl2N3O4 and a molecular weight of 556.49 g/mol. Its IUPAC name is methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-methyl-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-methyl-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 59665307 |
| Molecular Formula | C29H31Cl2N3O4 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-[2-methyl-2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCC(C)(C)c2ccc3c(n2)NCCC3)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C29H31Cl2N3O4/c1-29(2,24-14-11-19-6-5-15-32-26(19)34-24)17-38-20-12-9-18(10-13-20)16-23(28(36)37-3)33-27(35)25-21(30)7-4-8-22(25)31/h4,7-14,23H,5-6,15-17H2,1-3H3,(H,32,34)(H,33,35)/t23-/m0/s1 |
| InChIKey | JFQYJJONVPOMSK-QHCPKHFHSA-N |
| XLogP | 5.62 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |