C8H14ClN2O3- — CID 59669253
3-chloro-1,4-bis(ethylamino)-1,4-dioxobutan-2-olate (PubChem CID 59669253) has the molecular formula C8H14ClN2O3- and a molecular weight of 221.66 g/mol. Its IUPAC name is 3-chloro-1,4-bis(ethylamino)-1,4-dioxobutan-2-olate.
| Compound Name | 3-chloro-1,4-bis(ethylamino)-1,4-dioxobutan-2-olate |
|---|---|
| PubChem CID | 59669253 |
| Molecular Formula | C8H14ClN2O3- |
| Molecular Weight | 221.66 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-chloro-1,4-bis(ethylamino)-1,4-dioxobutan-2-olate |
| SMILES | CCNC(=O)C([O-])C(Cl)C(=O)NCC |
| InChI | InChI=1S/C8H14ClN2O3/c1-3-10-7(13)5(9)6(12)8(14)11-4-2/h5-6H,3-4H2,1-2H3,(H,10,13)(H,11,14)/q-1 |
| InChIKey | KQBFAACWMMVHIT-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.66 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|