C14H17NO6 — CID 59680689
7-(2,2-diethoxyethoxy)-1,3-benzoxazine-2,4-dione (PubChem CID 59680689) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 7-(2,2-diethoxyethoxy)-1,3-benzoxazine-2,4-dione.
| Compound Name | 7-(2,2-diethoxyethoxy)-1,3-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 59680689 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 7-(2,2-diethoxyethoxy)-1,3-benzoxazine-2,4-dione |
| SMILES | CCOC(COc1ccc2c(=O)[nH]c(=O)oc2c1)OCC |
| InChI | InChI=1S/C14H17NO6/c1-3-18-12(19-4-2)8-20-9-5-6-10-11(7-9)21-14(17)15-13(10)16/h5-7,12H,3-4,8H2,1-2H3,(H,15,16,17) |
| InChIKey | JPYXEHMQVUIBOK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|