C16H14BrNO3 — CID 61098561
6-[bromo-(4-ethoxyphenyl)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 61098561) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is 6-[bromo-(4-ethoxyphenyl)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[bromo-(4-ethoxyphenyl)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61098561 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 6-[bromo-(4-ethoxyphenyl)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CCOc1ccc(C(Br)c2ccc3[nH]c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C16H14BrNO3/c1-2-20-12-6-3-10(4-7-12)15(17)11-5-8-13-14(9-11)21-16(19)18-13/h3-9,15H,2H2,1H3,(H,18,19) |
| InChIKey | FGVSNBPRXXNWDJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|