C14H7BrF3NO2 — CID 79756906
6-[bromo-(2,3,4-trifluorophenyl)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 79756906) has the molecular formula C14H7BrF3NO2 and a molecular weight of 358.11 g/mol. Its IUPAC name is 6-[bromo-(2,3,4-trifluorophenyl)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[bromo-(2,3,4-trifluorophenyl)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79756906 |
| Molecular Formula | C14H7BrF3NO2 |
| Molecular Weight | 358.11 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 6-[bromo-(2,3,4-trifluorophenyl)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Br)c3ccc(F)c(F)c3F)cc2o1 |
| InChI | InChI=1S/C14H7BrF3NO2/c15-11(7-2-3-8(16)13(18)12(7)17)6-1-4-9-10(5-6)21-14(20)19-9/h1-5,11H,(H,19,20) |
| InChIKey | DSGVUIXNLZHYQG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.11 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|