C12H8BrNO3 — CID 61098364
6-[bromo(furan-2-yl)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 61098364) has the molecular formula C12H8BrNO3 and a molecular weight of 294.10 g/mol. Its IUPAC name is 6-[bromo(furan-2-yl)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[bromo(furan-2-yl)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61098364 |
| Molecular Formula | C12H8BrNO3 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 6-[bromo(furan-2-yl)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(Br)c3ccco3)cc2o1 |
| InChI | InChI=1S/C12H8BrNO3/c13-11(9-2-1-5-16-9)7-3-4-8-10(6-7)17-12(15)14-8/h1-6,11H,(H,14,15) |
| InChIKey | PFGJOUTWSJRORZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|