C13H10BrNO3 — CID 61097763
6-[bromo-(2-methylfuran-3-yl)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 61097763) has the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. Its IUPAC name is 6-[bromo-(2-methylfuran-3-yl)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[bromo-(2-methylfuran-3-yl)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61097763 |
| Molecular Formula | C13H10BrNO3 |
| Molecular Weight | 308.13 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 6-[bromo-(2-methylfuran-3-yl)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1occc1C(Br)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C13H10BrNO3/c1-7-9(4-5-17-7)12(14)8-2-3-10-11(6-8)18-13(16)15-10/h2-6,12H,1H3,(H,15,16) |
| InChIKey | WJZORCQMZXSVMA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.13 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|