About fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine
fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine (PubChem CID 59685581) has the molecular formula C15H15FN4Pt
and a molecular weight of 465.39 g/mol. Its IUPAC name is fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine.
Molecular Properties
| Compound Name | fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine |
| PubChem CID | 59685581 |
| Molecular Formula | C15H15FN4Pt |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine |
| SMILES | Cc1cc(Cn2[c-]ccc2)nc(Cn2cccn2)c1.F[Pt+] |
| InChI | InChI=1S/C15H15N4.FH.Pt/c1-13-9-14(11-18-6-2-3-7-18)17-15(10-13)12-19-8-4-5-16-19;;/h2-6,8-10H,11-12H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | WRKKAVMHHDHOKZ-UHFFFAOYSA-M |
| XLogP | 2.70 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine?
The IUPAC name of fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine (CID 59685581) is fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine.
What is the SMILES notation for fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine?
The canonical SMILES for fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine is Cc1cc(Cn2[c-]ccc2)nc(Cn2cccn2)c1.F[Pt+].
What is the InChIKey of fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine?
The InChIKey is WRKKAVMHHDHOKZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H15N4.FH.Pt/c1-13-9-14(11-18-6-2-3-7-18)17-15(10-13)12-19-8-4-5-16-19;;/h2-6,8-10H,11-12H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine?
fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine has a molecular weight of 465.39 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroplatinum(1+);4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine is sourced from PubChem (CID 59685581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).