C21H21N4OPd- — CID 59685721
4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine;palladium;phenol (PubChem CID 59685721) has the molecular formula C21H21N4OPd- and a molecular weight of 451.85 g/mol. Its IUPAC name is 4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine;palladium;phenol.
| Compound Name | 4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine;palladium;phenol |
|---|---|
| PubChem CID | 59685721 |
| Molecular Formula | C21H21N4OPd- |
| Molecular Weight | 451.85 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 4-methyl-2-(pyrazol-1-ylmethyl)-6-(2H-pyrrol-2-id-1-ylmethyl)pyridine;palladium;phenol |
| SMILES | Cc1cc(Cn2[c-]ccc2)nc(Cn2cccn2)c1.Oc1ccccc1.[Pd] |
| InChI | InChI=1S/C15H15N4.C6H6O.Pd/c1-13-9-14(11-18-6-2-3-7-18)17-15(10-13)12-19-8-4-5-16-19;7-6-4-2-1-3-5-6;/h2-6,8-10H,11-12H2,1H3;1-5,7H;/q-1;; |
| InChIKey | SYDSFLMXGGSRES-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|