C17H41N4O4+ — CID 59687872
[3-[2-aminoethyl-[2-(1-methoxypentan-2-yloxyamino)ethyl]amino]-2-hydroxypropyl]-(2-hydroxyethyl)-dimethylazanium (PubChem CID 59687872) has the molecular formula C17H41N4O4+ and a molecular weight of 365.54 g/mol. Its IUPAC name is [3-[2-aminoethyl-[2-(1-methoxypentan-2-yloxyamino)ethyl]amino]-2-hydroxypropyl]-(2-hydroxyethyl)-dimethylazanium.
| Compound Name | [3-[2-aminoethyl-[2-(1-methoxypentan-2-yloxyamino)ethyl]amino]-2-hydroxypropyl]-(2-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 59687872 |
| Molecular Formula | C17H41N4O4+ |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | [3-[2-aminoethyl-[2-(1-methoxypentan-2-yloxyamino)ethyl]amino]-2-hydroxypropyl]-(2-hydroxyethyl)-dimethylazanium |
| SMILES | CCCC(COC)ONCCN(CCN)CC(O)C[N+](C)(C)CCO |
| InChI | InChI=1S/C17H41N4O4/c1-5-6-17(15-24-4)25-19-8-10-20(9-7-18)13-16(23)14-21(2,3)11-12-22/h16-17,19,22-23H,5-15,18H2,1-4H3/q+1 |
| InChIKey | YXDDPDZBPREVBZ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|