C25H29N9O2 — CID 59689651
5-[4-(N-cyano-N'-quinolin-5-ylcarbamimidoyl)-3-propan-2-ylpiperazin-1-yl]-N-(2-hydroxyethyl)pyrazine-2-carboxamide (PubChem CID 59689651) has the molecular formula C25H29N9O2 and a molecular weight of 487.57 g/mol. Its IUPAC name is 5-[4-(N-cyano-N'-quinolin-5-ylcarbamimidoyl)-3-propan-2-ylpiperazin-1-yl]-N-(2-hydroxyethyl)pyrazine-2-carboxamide.
| Compound Name | 5-[4-(N-cyano-N'-quinolin-5-ylcarbamimidoyl)-3-propan-2-ylpiperazin-1-yl]-N-(2-hydroxyethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59689651 |
| Molecular Formula | C25H29N9O2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 5-[4-(N-cyano-N'-quinolin-5-ylcarbamimidoyl)-3-propan-2-ylpiperazin-1-yl]-N-(2-hydroxyethyl)pyrazine-2-carboxamide |
| SMILES | CC(C)C1CN(c2cnc(C(=O)NCCO)cn2)CCN1/C(=N/c1cccc2ncccc12)NC#N |
| InChI | InChI=1S/C25H29N9O2/c1-17(2)22-15-33(23-14-29-21(13-30-23)24(36)28-9-12-35)10-11-34(22)25(31-16-26)32-20-7-3-6-19-18(20)5-4-8-27-19/h3-8,13-14,17,22,35H,9-12,15H2,1-2H3,(H,28,36)(H,31,32) |
| InChIKey | MVLVZISDGZFFKZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|