C24H27N7O2S — CID 59690345
ethyl 2-[4-(N-cyano-N'-quinolin-5-ylcarbamimidoyl)-3-propan-2-ylpiperazin-1-yl]-1,3-thiazole-5-carboxylate (PubChem CID 59690345) has the molecular formula C24H27N7O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is ethyl 2-[4-(N-cyano-N'-quinolin-5-ylcarbamimidoyl)-3-propan-2-ylpiperazin-1-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[4-(N-cyano-N'-quinolin-5-ylcarbamimidoyl)-3-propan-2-ylpiperazin-1-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59690345 |
| Molecular Formula | C24H27N7O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | ethyl 2-[4-(N-cyano-N'-quinolin-5-ylcarbamimidoyl)-3-propan-2-ylpiperazin-1-yl]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCN(/C(=N/c3cccc4ncccc34)NC#N)C(C(C)C)C2)s1 |
| InChI | InChI=1S/C24H27N7O2S/c1-4-33-22(32)21-13-27-24(34-21)30-11-12-31(20(14-30)16(2)3)23(28-15-25)29-19-9-5-8-18-17(19)7-6-10-26-18/h5-10,13,16,20H,4,11-12,14H2,1-3H3,(H,28,29) |
| InChIKey | CHBHVDBFGXOHNR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|