C18H21N3O2 — CID 59697173
(2S)-3-amino-N-hydroxy-2-[[4-[(E)-2-phenylethenyl]phenyl]methylamino]propanamide (PubChem CID 59697173) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2S)-3-amino-N-hydroxy-2-[[4-[(E)-2-phenylethenyl]phenyl]methylamino]propanamide.
| Compound Name | (2S)-3-amino-N-hydroxy-2-[[4-[(E)-2-phenylethenyl]phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 59697173 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2S)-3-amino-N-hydroxy-2-[[4-[(E)-2-phenylethenyl]phenyl]methylamino]propanamide |
| SMILES | NC[C@H](NCc1ccc(/C=C/c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C18H21N3O2/c19-12-17(18(22)21-23)20-13-16-10-8-15(9-11-16)7-6-14-4-2-1-3-5-14/h1-11,17,20,23H,12-13,19H2,(H,21,22)/b7-6+/t17-/m0/s1 |
| InChIKey | IKVFIRLWULZJEF-LXXRFIIISA-N |
| XLogP | 1.78 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|