C23H29N3O4 — CID 173064439
tert-butyl-[(2S)-3-(hydroxyamino)-3-oxo-2-[[4-(2-phenylethenyl)phenyl]methylamino]propyl]carbamic acid (PubChem CID 173064439) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is tert-butyl-[(2S)-3-(hydroxyamino)-3-oxo-2-[[4-(2-phenylethenyl)phenyl]methylamino]propyl]carbamic acid.
| Compound Name | tert-butyl-[(2S)-3-(hydroxyamino)-3-oxo-2-[[4-(2-phenylethenyl)phenyl]methylamino]propyl]carbamic acid |
|---|---|
| PubChem CID | 173064439 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | tert-butyl-[(2S)-3-(hydroxyamino)-3-oxo-2-[[4-(2-phenylethenyl)phenyl]methylamino]propyl]carbamic acid |
| SMILES | CC(C)(C)N(C[C@H](NCc1ccc(C=Cc2ccccc2)cc1)C(=O)NO)C(=O)O |
| InChI | InChI=1S/C23H29N3O4/c1-23(2,3)26(22(28)29)16-20(21(27)25-30)24-15-19-13-11-18(12-14-19)10-9-17-7-5-4-6-8-17/h4-14,20,24,30H,15-16H2,1-3H3,(H,25,27)(H,28,29)/t20-/m0/s1 |
| InChIKey | ALYRIAWJEURPBO-FQEVSTJZSA-N |
| XLogP | 3.60 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|