C27H28N2O5 — CID 59697262
4-[4-(4-formylphenyl)buta-1,3-diynyl]-N-[(3R)-1-(methoxyamino)-3-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]benzamide (PubChem CID 59697262) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is 4-[4-(4-formylphenyl)buta-1,3-diynyl]-N-[(3R)-1-(methoxyamino)-3-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[4-(4-formylphenyl)buta-1,3-diynyl]-N-[(3R)-1-(methoxyamino)-3-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59697262 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 4-[4-(4-formylphenyl)buta-1,3-diynyl]-N-[(3R)-1-(methoxyamino)-3-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]benzamide |
| SMILES | CONC(=O)C(NC(=O)c1ccc(C#CC#Cc2ccc(C=O)cc2)cc1)[C@@H](C)OC(C)(C)C |
| InChI | InChI=1S/C27H28N2O5/c1-19(34-27(2,3)4)24(26(32)29-33-5)28-25(31)23-16-14-21(15-17-23)9-7-6-8-20-10-12-22(18-30)13-11-20/h10-19,24H,1-5H3,(H,28,31)(H,29,32)/t19-,24?/m1/s1 |
| InChIKey | SQDLSESNDJUANT-PHSANKKPSA-N |
| XLogP | 2.88 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|