C15H26N3O6S — CID 59703093
CID 59703093 (PubChem CID 59703093) has the molecular formula C15H26N3O6S and a molecular weight of 376.46 g/mol.
| Compound Name | CID 59703093 |
|---|---|
| PubChem CID | 59703093 |
| Molecular Formula | C15H26N3O6S |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | — |
| SMILES | NCCCCC([CH]C(=O)C(CS)NC(=O)CCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H26N3O6S/c16-6-2-1-3-9(14(21)22)7-12(19)11(8-25)18-13(20)5-4-10(17)15(23)24/h7,9-11,25H,1-6,8,16-17H2,(H,18,20)(H,21,22)(H,23,24) |
| InChIKey | DLGRLXGFZAEAEC-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 172.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|