C14H30NO+ — CID 59704160
2,2,3,3,4,4,5,5,6,6-decamethylmorpholin-4-ium (PubChem CID 59704160) has the molecular formula C14H30NO+ and a molecular weight of 228.40 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decamethylmorpholin-4-ium.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decamethylmorpholin-4-ium |
|---|---|
| PubChem CID | 59704160 |
| Molecular Formula | C14H30NO+ |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decamethylmorpholin-4-ium |
| SMILES | CC1(C)OC(C)(C)C(C)(C)[N+](C)(C)C1(C)C |
| InChI | InChI=1S/C14H30NO/c1-11(2)13(5,6)16-14(7,8)12(3,4)15(11,9)10/h1-10H3/q+1 |
| InChIKey | ZZFCMORKHDMUMV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|