C10H16O6 — CID 59710700
4-O-(2-hydroxyethyl) 1-O-(oxiran-2-yl) 2,2-dimethylbutanedioate (PubChem CID 59710700) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 4-O-(2-hydroxyethyl) 1-O-(oxiran-2-yl) 2,2-dimethylbutanedioate.
| Compound Name | 4-O-(2-hydroxyethyl) 1-O-(oxiran-2-yl) 2,2-dimethylbutanedioate |
|---|---|
| PubChem CID | 59710700 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 4-O-(2-hydroxyethyl) 1-O-(oxiran-2-yl) 2,2-dimethylbutanedioate |
| SMILES | CC(C)(CC(=O)OCCO)C(=O)OC1CO1 |
| InChI | InChI=1S/C10H16O6/c1-10(2,5-7(12)14-4-3-11)9(13)16-8-6-15-8/h8,11H,3-6H2,1-2H3 |
| InChIKey | LARXMPYWCOPJER-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|