C45H24F18N6 — CID 59711247
2-N,2-N,4-N,4-N,6-N,6-N-hexakis[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 59711247) has the molecular formula C45H24F18N6 and a molecular weight of 990.69 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexakis[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexakis[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 59711247 |
| Molecular Formula | C45H24F18N6 |
| Molecular Weight | 990.69 g/mol |
| Exact Mass | 990.18 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexakis[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | FC(F)(F)c1ccc(N(c2ccc(C(F)(F)F)cc2)c2nc(N(c3ccc(C(F)(F)F)cc3)c3ccc(C(F)(F)F)cc3)nc(N(c3ccc(C(F)(F)F)cc3)c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C45H24F18N6/c46-40(47,48)25-1-13-31(14-2-25)67(32-15-3-26(4-16-32)41(49,50)51)37-64-38(68(33-17-5-27(6-18-33)42(52,53)54)34-19-7-28(8-20-34)43(55,56)57)66-39(65-37)69(35-21-9-29(10-22-35)44(58,59)60)36-23-11-30(12-24-36)45(61,62)63/h1-24H |
| InChIKey | XSQVQKOTLWQZNV-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.69 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |