C18H20N2O3 — CID 59712916
ethenyl (1S,2S,4S,5R,6R)-2-cyano-4-hydroxy-2-[[(1R)-1-phenylethyl]amino]bicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 59712916) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethenyl (1S,2S,4S,5R,6R)-2-cyano-4-hydroxy-2-[[(1R)-1-phenylethyl]amino]bicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethenyl (1S,2S,4S,5R,6R)-2-cyano-4-hydroxy-2-[[(1R)-1-phenylethyl]amino]bicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 59712916 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | ethenyl (1S,2S,4S,5R,6R)-2-cyano-4-hydroxy-2-[[(1R)-1-phenylethyl]amino]bicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | C=COC(=O)[C@H]1[C@H]2[C@@H]1[C@@](C#N)(N[C@H](C)c1ccccc1)C[C@@H]2O |
| InChI | InChI=1S/C18H20N2O3/c1-3-23-17(22)15-14-13(21)9-18(10-19,16(14)15)20-11(2)12-7-5-4-6-8-12/h3-8,11,13-16,20-21H,1,9H2,2H3/t11-,13+,14+,15+,16+,18-/m1/s1 |
| InChIKey | MLFJZNMEGUKORA-BIJWALSUSA-N |
| XLogP | 1.91 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|